C11H18N2O5S — CID 106100249
5-[[(3-hydroxy-2-methyloxolan-3-yl)methylamino]methyl]furan-2-sulfonamide (PubChem CID 106100249) has the molecular formula C11H18N2O5S and a molecular weight of 290.34 g/mol. Its IUPAC name is 5-[[(3-hydroxy-2-methyloxolan-3-yl)methylamino]methyl]furan-2-sulfonamide.
| Compound Name | 5-[[(3-hydroxy-2-methyloxolan-3-yl)methylamino]methyl]furan-2-sulfonamide |
|---|---|
| PubChem CID | 106100249 |
| Molecular Formula | C11H18N2O5S |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 5-[[(3-hydroxy-2-methyloxolan-3-yl)methylamino]methyl]furan-2-sulfonamide |
| SMILES | CC1OCCC1(O)CNCc1ccc(S(N)(=O)=O)o1 |
| InChI | InChI=1S/C11H18N2O5S/c1-8-11(14,4-5-17-8)7-13-6-9-2-3-10(18-9)19(12,15)16/h2-3,8,13-14H,4-7H2,1H3,(H2,12,15,16) |
| InChIKey | FYRBJQAQXTZDLC-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 114.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |