About 3-[[2-(2,2,2-trifluoroethoxy)ethylamino]methyl]oxolan-3-ol
3-[[2-(2,2,2-trifluoroethoxy)ethylamino]methyl]oxolan-3-ol (PubChem CID 106100420) has the molecular formula C9H16F3NO3
and a molecular weight of 243.22 g/mol. Its IUPAC name is 3-[[2-(2,2,2-trifluoroethoxy)ethylamino]methyl]oxolan-3-ol.
Molecular Properties
| Compound Name | 3-[[2-(2,2,2-trifluoroethoxy)ethylamino]methyl]oxolan-3-ol |
| PubChem CID | 106100420 |
| Molecular Formula | C9H16F3NO3 |
| Molecular Weight | 243.22 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | 3-[[2-(2,2,2-trifluoroethoxy)ethylamino]methyl]oxolan-3-ol |
| SMILES | OC1(CNCCOCC(F)(F)F)CCOC1 |
| InChI | InChI=1S/C9H16F3NO3/c10-9(11,12)7-16-4-2-13-5-8(14)1-3-15-6-8/h13-14H,1-7H2 |
| InChIKey | KUIOUQLHUCKLDA-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.22 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[[2-(2,2,2-trifluoroethoxy)ethylamino]methyl]oxolan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[2-(2,2,2-trifluoroethoxy)ethylamino]methyl]oxolan-3-ol?
The IUPAC name of 3-[[2-(2,2,2-trifluoroethoxy)ethylamino]methyl]oxolan-3-ol (CID 106100420) is 3-[[2-(2,2,2-trifluoroethoxy)ethylamino]methyl]oxolan-3-ol.
What is the SMILES notation for 3-[[2-(2,2,2-trifluoroethoxy)ethylamino]methyl]oxolan-3-ol?
The canonical SMILES for 3-[[2-(2,2,2-trifluoroethoxy)ethylamino]methyl]oxolan-3-ol is OC1(CNCCOCC(F)(F)F)CCOC1.
What is the InChIKey of 3-[[2-(2,2,2-trifluoroethoxy)ethylamino]methyl]oxolan-3-ol?
The InChIKey is KUIOUQLHUCKLDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16F3NO3/c10-9(11,12)7-16-4-2-13-5-8(14)1-3-15-6-8/h13-14H,1-7H2.
What are the key properties of 3-[[2-(2,2,2-trifluoroethoxy)ethylamino]methyl]oxolan-3-ol?
3-[[2-(2,2,2-trifluoroethoxy)ethylamino]methyl]oxolan-3-ol has a molecular weight of 243.22 g/mol, XLogP of 0.31, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[2-(2,2,2-trifluoroethoxy)ethylamino]methyl]oxolan-3-ol is sourced from PubChem (CID 106100420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).