About 3-[[(3,3,3-trifluoro-2-hydroxypropyl)amino]methyl]oxolan-3-ol
3-[[(3,3,3-trifluoro-2-hydroxypropyl)amino]methyl]oxolan-3-ol (PubChem CID 106100444) has the molecular formula C8H14F3NO3
and a molecular weight of 229.20 g/mol. Its IUPAC name is 3-[[(3,3,3-trifluoro-2-hydroxypropyl)amino]methyl]oxolan-3-ol.
Molecular Properties
| Compound Name | 3-[[(3,3,3-trifluoro-2-hydroxypropyl)amino]methyl]oxolan-3-ol |
| PubChem CID | 106100444 |
| Molecular Formula | C8H14F3NO3 |
| Molecular Weight | 229.20 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 3-[[(3,3,3-trifluoro-2-hydroxypropyl)amino]methyl]oxolan-3-ol |
| SMILES | OC(CNCC1(O)CCOC1)C(F)(F)F |
| InChI | InChI=1S/C8H14F3NO3/c9-8(10,11)6(13)3-12-4-7(14)1-2-15-5-7/h6,12-14H,1-5H2 |
| InChIKey | NCTAFFFTQNWTAO-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.20 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[[(3,3,3-trifluoro-2-hydroxypropyl)amino]methyl]oxolan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[(3,3,3-trifluoro-2-hydroxypropyl)amino]methyl]oxolan-3-ol?
The IUPAC name of 3-[[(3,3,3-trifluoro-2-hydroxypropyl)amino]methyl]oxolan-3-ol (CID 106100444) is 3-[[(3,3,3-trifluoro-2-hydroxypropyl)amino]methyl]oxolan-3-ol.
What is the SMILES notation for 3-[[(3,3,3-trifluoro-2-hydroxypropyl)amino]methyl]oxolan-3-ol?
The canonical SMILES for 3-[[(3,3,3-trifluoro-2-hydroxypropyl)amino]methyl]oxolan-3-ol is OC(CNCC1(O)CCOC1)C(F)(F)F.
What is the InChIKey of 3-[[(3,3,3-trifluoro-2-hydroxypropyl)amino]methyl]oxolan-3-ol?
The InChIKey is NCTAFFFTQNWTAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14F3NO3/c9-8(10,11)6(13)3-12-4-7(14)1-2-15-5-7/h6,12-14H,1-5H2.
What are the key properties of 3-[[(3,3,3-trifluoro-2-hydroxypropyl)amino]methyl]oxolan-3-ol?
3-[[(3,3,3-trifluoro-2-hydroxypropyl)amino]methyl]oxolan-3-ol has a molecular weight of 229.20 g/mol, XLogP of -0.35, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[(3,3,3-trifluoro-2-hydroxypropyl)amino]methyl]oxolan-3-ol is sourced from PubChem (CID 106100444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).