About 3-[(2,2-difluoroethylamino)methyl]oxolan-3-ol
3-[(2,2-difluoroethylamino)methyl]oxolan-3-ol (PubChem CID 106100612) has the molecular formula C7H13F2NO2
and a molecular weight of 181.18 g/mol. Its IUPAC name is 3-[(2,2-difluoroethylamino)methyl]oxolan-3-ol.
Molecular Properties
| Compound Name | 3-[(2,2-difluoroethylamino)methyl]oxolan-3-ol |
| PubChem CID | 106100612 |
| Molecular Formula | C7H13F2NO2 |
| Molecular Weight | 181.18 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | 3-[(2,2-difluoroethylamino)methyl]oxolan-3-ol |
| SMILES | OC1(CNCC(F)F)CCOC1 |
| InChI | InChI=1S/C7H13F2NO2/c8-6(9)3-10-4-7(11)1-2-12-5-7/h6,10-11H,1-5H2 |
| InChIKey | SSPXLTBMTOJGIO-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.18 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(2,2-difluoroethylamino)methyl]oxolan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2,2-difluoroethylamino)methyl]oxolan-3-ol?
The IUPAC name of 3-[(2,2-difluoroethylamino)methyl]oxolan-3-ol (CID 106100612) is 3-[(2,2-difluoroethylamino)methyl]oxolan-3-ol.
What is the SMILES notation for 3-[(2,2-difluoroethylamino)methyl]oxolan-3-ol?
The canonical SMILES for 3-[(2,2-difluoroethylamino)methyl]oxolan-3-ol is OC1(CNCC(F)F)CCOC1.
What is the InChIKey of 3-[(2,2-difluoroethylamino)methyl]oxolan-3-ol?
The InChIKey is SSPXLTBMTOJGIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13F2NO2/c8-6(9)3-10-4-7(11)1-2-12-5-7/h6,10-11H,1-5H2.
What are the key properties of 3-[(2,2-difluoroethylamino)methyl]oxolan-3-ol?
3-[(2,2-difluoroethylamino)methyl]oxolan-3-ol has a molecular weight of 181.18 g/mol, XLogP of -0.01, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2,2-difluoroethylamino)methyl]oxolan-3-ol is sourced from PubChem (CID 106100612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).