C11H21NO3 — CID 106100705
3-[[[(1R,2R)-2-hydroxycyclohexyl]amino]methyl]oxolan-3-ol (PubChem CID 106100705) has the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. Its IUPAC name is 3-[[[(1R,2R)-2-hydroxycyclohexyl]amino]methyl]oxolan-3-ol.
| Compound Name | 3-[[[(1R,2R)-2-hydroxycyclohexyl]amino]methyl]oxolan-3-ol |
|---|---|
| PubChem CID | 106100705 |
| Molecular Formula | C11H21NO3 |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | 3-[[[(1R,2R)-2-hydroxycyclohexyl]amino]methyl]oxolan-3-ol |
| SMILES | O[C@@H]1CCCC[C@H]1NCC1(O)CCOC1 |
| InChI | InChI=1S/C11H21NO3/c13-10-4-2-1-3-9(10)12-7-11(14)5-6-15-8-11/h9-10,12-14H,1-8H2/t9-,10-,11?/m1/s1 |
| InChIKey | ACYYREWTRBGQCU-DIOIDXFWSA-N |
| XLogP | 0.03 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |