C14H19ClN2O3 — CID 106100732
N-(5-chloro-2-methylphenyl)-2-[(3-hydroxyoxolan-3-yl)methylamino]acetamide (PubChem CID 106100732) has the molecular formula C14H19ClN2O3 and a molecular weight of 298.77 g/mol. Its IUPAC name is N-(5-chloro-2-methylphenyl)-2-[(3-hydroxyoxolan-3-yl)methylamino]acetamide.
| Compound Name | N-(5-chloro-2-methylphenyl)-2-[(3-hydroxyoxolan-3-yl)methylamino]acetamide |
|---|---|
| PubChem CID | 106100732 |
| Molecular Formula | C14H19ClN2O3 |
| Molecular Weight | 298.77 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | N-(5-chloro-2-methylphenyl)-2-[(3-hydroxyoxolan-3-yl)methylamino]acetamide |
| SMILES | Cc1ccc(Cl)cc1NC(=O)CNCC1(O)CCOC1 |
| InChI | InChI=1S/C14H19ClN2O3/c1-10-2-3-11(15)6-12(10)17-13(18)7-16-8-14(19)4-5-20-9-14/h2-3,6,16,19H,4-5,7-9H2,1H3,(H,17,18) |
| InChIKey | NBGOVZCEQQMHDW-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.77 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |