About 2-methyl-3-[(4,4,4-trifluorobutylamino)methyl]oxolan-3-ol
2-methyl-3-[(4,4,4-trifluorobutylamino)methyl]oxolan-3-ol (PubChem CID 106101017) has the molecular formula C10H18F3NO2
and a molecular weight of 241.25 g/mol. Its IUPAC name is 2-methyl-3-[(4,4,4-trifluorobutylamino)methyl]oxolan-3-ol.
Molecular Properties
| Compound Name | 2-methyl-3-[(4,4,4-trifluorobutylamino)methyl]oxolan-3-ol |
| PubChem CID | 106101017 |
| Molecular Formula | C10H18F3NO2 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | 2-methyl-3-[(4,4,4-trifluorobutylamino)methyl]oxolan-3-ol |
| SMILES | CC1OCCC1(O)CNCCCC(F)(F)F |
| InChI | InChI=1S/C10H18F3NO2/c1-8-9(15,4-6-16-8)7-14-5-2-3-10(11,12)13/h8,14-15H,2-7H2,1H3 |
| InChIKey | IKKNHDSGZXQDHD-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-3-[(4,4,4-trifluorobutylamino)methyl]oxolan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-3-[(4,4,4-trifluorobutylamino)methyl]oxolan-3-ol?
The IUPAC name of 2-methyl-3-[(4,4,4-trifluorobutylamino)methyl]oxolan-3-ol (CID 106101017) is 2-methyl-3-[(4,4,4-trifluorobutylamino)methyl]oxolan-3-ol.
What is the SMILES notation for 2-methyl-3-[(4,4,4-trifluorobutylamino)methyl]oxolan-3-ol?
The canonical SMILES for 2-methyl-3-[(4,4,4-trifluorobutylamino)methyl]oxolan-3-ol is CC1OCCC1(O)CNCCCC(F)(F)F.
What is the InChIKey of 2-methyl-3-[(4,4,4-trifluorobutylamino)methyl]oxolan-3-ol?
The InChIKey is IKKNHDSGZXQDHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18F3NO2/c1-8-9(15,4-6-16-8)7-14-5-2-3-10(11,12)13/h8,14-15H,2-7H2,1H3.
What are the key properties of 2-methyl-3-[(4,4,4-trifluorobutylamino)methyl]oxolan-3-ol?
2-methyl-3-[(4,4,4-trifluorobutylamino)methyl]oxolan-3-ol has a molecular weight of 241.25 g/mol, XLogP of 1.46, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3-[(4,4,4-trifluorobutylamino)methyl]oxolan-3-ol is sourced from PubChem (CID 106101017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).