About N'-hydroxy-6-[(3-hydroxyoxolan-3-yl)methylamino]-2,2-dimethylhexanimidamide
N'-hydroxy-6-[(3-hydroxyoxolan-3-yl)methylamino]-2,2-dimethylhexanimidamide (PubChem CID 106101835) has the molecular formula C13H27N3O3
and a molecular weight of 273.38 g/mol. Its IUPAC name is N'-hydroxy-6-[(3-hydroxyoxolan-3-yl)methylamino]-2,2-dimethylhexanimidamide.
Molecular Properties
| Compound Name | N'-hydroxy-6-[(3-hydroxyoxolan-3-yl)methylamino]-2,2-dimethylhexanimidamide |
| PubChem CID | 106101835 |
| Molecular Formula | C13H27N3O3 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.21 |
| IUPAC Name | N'-hydroxy-6-[(3-hydroxyoxolan-3-yl)methylamino]-2,2-dimethylhexanimidamide |
| SMILES | CC(C)(CCCCNCC1(O)CCOC1)C(N)=NO |
| InChI | InChI=1S/C13H27N3O3/c1-12(2,11(14)16-18)5-3-4-7-15-9-13(17)6-8-19-10-13/h15,17-18H,3-10H2,1-2H3,(H2,14,16) |
| InChIKey | MKCAAYKRXAOFPG-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-hydroxy-6-[(3-hydroxyoxolan-3-yl)methylamino]-2,2-dimethylhexanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-hydroxy-6-[(3-hydroxyoxolan-3-yl)methylamino]-2,2-dimethylhexanimidamide?
The IUPAC name of N'-hydroxy-6-[(3-hydroxyoxolan-3-yl)methylamino]-2,2-dimethylhexanimidamide (CID 106101835) is N'-hydroxy-6-[(3-hydroxyoxolan-3-yl)methylamino]-2,2-dimethylhexanimidamide.
What is the SMILES notation for N'-hydroxy-6-[(3-hydroxyoxolan-3-yl)methylamino]-2,2-dimethylhexanimidamide?
The canonical SMILES for N'-hydroxy-6-[(3-hydroxyoxolan-3-yl)methylamino]-2,2-dimethylhexanimidamide is CC(C)(CCCCNCC1(O)CCOC1)C(N)=NO.
What is the InChIKey of N'-hydroxy-6-[(3-hydroxyoxolan-3-yl)methylamino]-2,2-dimethylhexanimidamide?
The InChIKey is MKCAAYKRXAOFPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27N3O3/c1-12(2,11(14)16-18)5-3-4-7-15-9-13(17)6-8-19-10-13/h15,17-18H,3-10H2,1-2H3,(H2,14,16).
What are the key properties of N'-hydroxy-6-[(3-hydroxyoxolan-3-yl)methylamino]-2,2-dimethylhexanimidamide?
N'-hydroxy-6-[(3-hydroxyoxolan-3-yl)methylamino]-2,2-dimethylhexanimidamide has a molecular weight of 273.38 g/mol, XLogP of 0.67, 8 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-hydroxy-6-[(3-hydroxyoxolan-3-yl)methylamino]-2,2-dimethylhexanimidamide is sourced from PubChem (CID 106101835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).