C10H15NO3 — CID 106102911
N-[(3-hydroxy-2-methyloxolan-3-yl)methyl]but-2-ynamide (PubChem CID 106102911) has the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. Its IUPAC name is N-[(3-hydroxy-2-methyloxolan-3-yl)methyl]but-2-ynamide.
| Compound Name | N-[(3-hydroxy-2-methyloxolan-3-yl)methyl]but-2-ynamide |
|---|---|
| PubChem CID | 106102911 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | N-[(3-hydroxy-2-methyloxolan-3-yl)methyl]but-2-ynamide |
| SMILES | CC#CC(=O)NCC1(O)CCOC1C |
| InChI | InChI=1S/C10H15NO3/c1-3-4-9(12)11-7-10(13)5-6-14-8(10)2/h8,13H,5-7H2,1-2H3,(H,11,12) |
| InChIKey | REHAUJUQIUFMDY-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|