C16H22O2 — CID 10610453
(5Z,8Z,11Z,14Z,16S)-16-methyl-1-oxacyclohexadeca-5,8,11,14-tetraen-2-one (PubChem CID 10610453) has the molecular formula C16H22O2 and a molecular weight of 246.35 g/mol. Its IUPAC name is (5Z,8Z,11Z,14Z,16S)-16-methyl-1-oxacyclohexadeca-5,8,11,14-tetraen-2-one.
| Compound Name | (5Z,8Z,11Z,14Z,16S)-16-methyl-1-oxacyclohexadeca-5,8,11,14-tetraen-2-one |
|---|---|
| PubChem CID | 10610453 |
| Molecular Formula | C16H22O2 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | (5Z,8Z,11Z,14Z,16S)-16-methyl-1-oxacyclohexadeca-5,8,11,14-tetraen-2-one |
| SMILES | C[C@H]1/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)O1 |
| InChI | InChI=1S/C16H22O2/c1-15-13-11-9-7-5-3-2-4-6-8-10-12-14-16(17)18-15/h2,4-5,7-8,10-11,13,15H,3,6,9,12,14H2,1H3/b4-2-,7-5-,10-8-,13-11-/t15-/m0/s1 |
| InChIKey | DDYJELFWYWXJTE-ZIPUTLTESA-N |
| XLogP | 4.11 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|