C8H13N3O6 — CID 10610478
1-[(2R,3R,4R,5R)-3,4,5-trihydroxyoxan-2-yl]-1,2,4-triazinane-3,5-dione (PubChem CID 10610478) has the molecular formula C8H13N3O6 and a molecular weight of 247.21 g/mol. Its IUPAC name is 1-[(2R,3R,4R,5R)-3,4,5-trihydroxyoxan-2-yl]-1,2,4-triazinane-3,5-dione.
| Compound Name | 1-[(2R,3R,4R,5R)-3,4,5-trihydroxyoxan-2-yl]-1,2,4-triazinane-3,5-dione |
|---|---|
| PubChem CID | 10610478 |
| Molecular Formula | C8H13N3O6 |
| Molecular Weight | 247.21 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | 1-[(2R,3R,4R,5R)-3,4,5-trihydroxyoxan-2-yl]-1,2,4-triazinane-3,5-dione |
| SMILES | O=C1CN([C@@H]2OC[C@@H](O)[C@@H](O)[C@H]2O)NC(=O)N1 |
| InChI | InChI=1S/C8H13N3O6/c12-3-2-17-7(6(15)5(3)14)11-1-4(13)9-8(16)10-11/h3,5-7,12,14-15H,1-2H2,(H2,9,10,13,16)/t3-,5-,6-,7-/m1/s1 |
| InChIKey | NLJXKPCZNJQPRS-SHUUEZRQSA-N |
| XLogP | -3.52 |
| TPSA | 131.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.21 |
| LogP ≤ 5 | -3.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |