C14H17NO3 — CID 10610497
(3aR,7R)-2,2-dimethyl-7-phenyl-3,3a,6,7-tetrahydro-[1,2]oxazolo[3,2-c][1,4]oxazin-4-one (PubChem CID 10610497) has the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. Its IUPAC name is (3aR,7R)-2,2-dimethyl-7-phenyl-3,3a,6,7-tetrahydro-[1,2]oxazolo[3,2-c][1,4]oxazin-4-one.
| Compound Name | (3aR,7R)-2,2-dimethyl-7-phenyl-3,3a,6,7-tetrahydro-[1,2]oxazolo[3,2-c][1,4]oxazin-4-one |
|---|---|
| PubChem CID | 10610497 |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | (3aR,7R)-2,2-dimethyl-7-phenyl-3,3a,6,7-tetrahydro-[1,2]oxazolo[3,2-c][1,4]oxazin-4-one |
| SMILES | CC1(C)C[C@@H]2C(=O)OC[C@@H](c3ccccc3)N2O1 |
| InChI | InChI=1S/C14H17NO3/c1-14(2)8-11-13(16)17-9-12(15(11)18-14)10-6-4-3-5-7-10/h3-7,11-12H,8-9H2,1-2H3/t11-,12+/m1/s1 |
| InChIKey | TVNVCWHWRVKDBZ-NEPJUHHUSA-N |
| XLogP | 2.07 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |