C15H21NO2 — CID 10610505
(4aR,11aR)-7,8-dimethyl-2,3,4,4a,10,10a,11,11a-octahydro-1H-azepino[1,2-a]indole-6,9-dione (PubChem CID 10610505) has the molecular formula C15H21NO2 and a molecular weight of 247.34 g/mol. Its IUPAC name is (4aR,11aR)-7,8-dimethyl-2,3,4,4a,10,10a,11,11a-octahydro-1H-azepino[1,2-a]indole-6,9-dione.
| Compound Name | (4aR,11aR)-7,8-dimethyl-2,3,4,4a,10,10a,11,11a-octahydro-1H-azepino[1,2-a]indole-6,9-dione |
|---|---|
| PubChem CID | 10610505 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | (4aR,11aR)-7,8-dimethyl-2,3,4,4a,10,10a,11,11a-octahydro-1H-azepino[1,2-a]indole-6,9-dione |
| SMILES | CC1=C(C)C(=O)N2C(CC1=O)C[C@H]1CCCC[C@H]12 |
| InChI | InChI=1S/C15H21NO2/c1-9-10(2)15(18)16-12(8-14(9)17)7-11-5-3-4-6-13(11)16/h11-13H,3-8H2,1-2H3/t11-,12?,13-/m1/s1 |
| InChIKey | HWDCBRJBRRIKNB-LKOMHFJYSA-N |
| XLogP | 2.46 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |