C15H28N4O — CID 106105094
4-(2-aminoethyl)-5-methyl-N-[2-(1-methylpyrazol-3-yl)ethyl]hexanamide (PubChem CID 106105094) has the molecular formula C15H28N4O and a molecular weight of 280.42 g/mol. Its IUPAC name is 4-(2-aminoethyl)-5-methyl-N-[2-(1-methylpyrazol-3-yl)ethyl]hexanamide.
| Compound Name | 4-(2-aminoethyl)-5-methyl-N-[2-(1-methylpyrazol-3-yl)ethyl]hexanamide |
|---|---|
| PubChem CID | 106105094 |
| Molecular Formula | C15H28N4O |
| Molecular Weight | 280.42 g/mol |
| Exact Mass | 280.23 |
| IUPAC Name | 4-(2-aminoethyl)-5-methyl-N-[2-(1-methylpyrazol-3-yl)ethyl]hexanamide |
| SMILES | CC(C)C(CCN)CCC(=O)NCCc1ccn(C)n1 |
| InChI | InChI=1S/C15H28N4O/c1-12(2)13(6-9-16)4-5-15(20)17-10-7-14-8-11-19(3)18-14/h8,11-13H,4-7,9-10,16H2,1-3H3,(H,17,20) |
| InChIKey | RPHAQFGMWQIRSA-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.42 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |