C12H13N5S2 — CID 106105623
4-[2-(1-methylpyrazol-3-yl)ethyl]-3-thiophen-2-yl-1H-1,2,4-triazole-5-thione (PubChem CID 106105623) has the molecular formula C12H13N5S2 and a molecular weight of 291.41 g/mol. Its IUPAC name is 4-[2-(1-methylpyrazol-3-yl)ethyl]-3-thiophen-2-yl-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[2-(1-methylpyrazol-3-yl)ethyl]-3-thiophen-2-yl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 106105623 |
| Molecular Formula | C12H13N5S2 |
| Molecular Weight | 291.41 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | 4-[2-(1-methylpyrazol-3-yl)ethyl]-3-thiophen-2-yl-1H-1,2,4-triazole-5-thione |
| SMILES | Cn1ccc(CCn2c(-c3cccs3)n[nH]c2=S)n1 |
| InChI | InChI=1S/C12H13N5S2/c1-16-6-4-9(15-16)5-7-17-11(13-14-12(17)18)10-3-2-8-19-10/h2-4,6,8H,5,7H2,1H3,(H,14,18) |
| InChIKey | RLHLPLMFAOJUHD-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 51.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.41 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|