C16H24O2 — CID 10610583
(1R,4S,5R,7S,11R)-11-butyl-4-hydroxy-6-methylidenetricyclo[5.3.1.01,5]undecan-10-one (PubChem CID 10610583) has the molecular formula C16H24O2 and a molecular weight of 248.37 g/mol. Its IUPAC name is (1R,4S,5R,7S,11R)-11-butyl-4-hydroxy-6-methylidenetricyclo[5.3.1.01,5]undecan-10-one.
| Compound Name | (1R,4S,5R,7S,11R)-11-butyl-4-hydroxy-6-methylidenetricyclo[5.3.1.01,5]undecan-10-one |
|---|---|
| PubChem CID | 10610583 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | (1R,4S,5R,7S,11R)-11-butyl-4-hydroxy-6-methylidenetricyclo[5.3.1.01,5]undecan-10-one |
| SMILES | C=C1[C@H]2CCC(=O)[C@]3(CC[C@H](O)[C@H]13)[C@@H]2CCCC |
| InChI | InChI=1S/C16H24O2/c1-3-4-5-12-11-6-7-14(18)16(12)9-8-13(17)15(16)10(11)2/h11-13,15,17H,2-9H2,1H3/t11-,12-,13+,15+,16+/m1/s1 |
| InChIKey | GIUDHVCZTISEKA-KLUNEYRZSA-N |
| XLogP | 3.10 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|