C15H22O3 — CID 10610694
(2S,4R,5R,6S,7R)-4,7-dihydroxy-6,10-dimethyl-2-prop-1-en-2-ylspiro[4.5]dec-9-en-8-one (PubChem CID 10610694) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is (2S,4R,5R,6S,7R)-4,7-dihydroxy-6,10-dimethyl-2-prop-1-en-2-ylspiro[4.5]dec-9-en-8-one.
| Compound Name | (2S,4R,5R,6S,7R)-4,7-dihydroxy-6,10-dimethyl-2-prop-1-en-2-ylspiro[4.5]dec-9-en-8-one |
|---|---|
| PubChem CID | 10610694 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | (2S,4R,5R,6S,7R)-4,7-dihydroxy-6,10-dimethyl-2-prop-1-en-2-ylspiro[4.5]dec-9-en-8-one |
| SMILES | C=C(C)[C@@H]1C[C@@H](O)[C@@]2(C1)C(C)=CC(=O)[C@H](O)[C@H]2C |
| InChI | InChI=1S/C15H22O3/c1-8(2)11-6-13(17)15(7-11)9(3)5-12(16)14(18)10(15)4/h5,10-11,13-14,17-18H,1,6-7H2,2-4H3/t10-,11-,13-,14-,15+/m1/s1 |
| InChIKey | BLDKDCBSDHBTFV-BBIZWXPBSA-N |
| XLogP | 1.85 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|