C16H26O2 — CID 10610711
3,6-bis(1-ethoxyethyl)octa-1,2,6,7-tetraene (PubChem CID 10610711) has the molecular formula C16H26O2 and a molecular weight of 250.38 g/mol. Its IUPAC name is 3,6-bis(1-ethoxyethyl)octa-1,2,6,7-tetraene.
| Compound Name | 3,6-bis(1-ethoxyethyl)octa-1,2,6,7-tetraene |
|---|---|
| PubChem CID | 10610711 |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | 3,6-bis(1-ethoxyethyl)octa-1,2,6,7-tetraene |
| SMILES | C=C=C(CCC(=C=C)C(C)OCC)C(C)OCC |
| InChI | InChI=1S/C16H26O2/c1-7-15(13(5)17-9-3)11-12-16(8-2)14(6)18-10-4/h13-14H,1-2,9-12H2,3-6H3 |
| InChIKey | AUDOMXVGYANHBA-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |