C9H15NO4S — CID 106107998
2-methoxy-3-(thiolane-2-carbonylamino)propanoic acid (PubChem CID 106107998) has the molecular formula C9H15NO4S and a molecular weight of 233.29 g/mol. Its IUPAC name is 2-methoxy-3-(thiolane-2-carbonylamino)propanoic acid.
| Compound Name | 2-methoxy-3-(thiolane-2-carbonylamino)propanoic acid |
|---|---|
| PubChem CID | 106107998 |
| Molecular Formula | C9H15NO4S |
| Molecular Weight | 233.29 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | 2-methoxy-3-(thiolane-2-carbonylamino)propanoic acid |
| SMILES | COC(CNC(=O)C1CCCS1)C(=O)O |
| InChI | InChI=1S/C9H15NO4S/c1-14-6(9(12)13)5-10-8(11)7-3-2-4-15-7/h6-7H,2-5H2,1H3,(H,10,11)(H,12,13) |
| InChIKey | UWWYGUMXQFYMBR-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.29 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |