C12H14FNO5 — CID 106108177
3-[(4-fluoro-3-methoxybenzoyl)amino]-2-methoxypropanoic acid (PubChem CID 106108177) has the molecular formula C12H14FNO5 and a molecular weight of 271.24 g/mol. Its IUPAC name is 3-[(4-fluoro-3-methoxybenzoyl)amino]-2-methoxypropanoic acid.
| Compound Name | 3-[(4-fluoro-3-methoxybenzoyl)amino]-2-methoxypropanoic acid |
|---|---|
| PubChem CID | 106108177 |
| Molecular Formula | C12H14FNO5 |
| Molecular Weight | 271.24 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | 3-[(4-fluoro-3-methoxybenzoyl)amino]-2-methoxypropanoic acid |
| SMILES | COc1cc(C(=O)NCC(OC)C(=O)O)ccc1F |
| InChI | InChI=1S/C12H14FNO5/c1-18-9-5-7(3-4-8(9)13)11(15)14-6-10(19-2)12(16)17/h3-5,10H,6H2,1-2H3,(H,14,15)(H,16,17) |
| InChIKey | AKGFHKFZFNZJFY-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.24 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |