C15H30OSi — CID 10610997
1-[tert-butyl(dimethyl)silyl]-3-[(1R,3S)-3-methylcyclopentyl]propan-1-one (PubChem CID 10610997) has the molecular formula C15H30OSi and a molecular weight of 254.49 g/mol. Its IUPAC name is 1-[tert-butyl(dimethyl)silyl]-3-[(1R,3S)-3-methylcyclopentyl]propan-1-one.
| Compound Name | 1-[tert-butyl(dimethyl)silyl]-3-[(1R,3S)-3-methylcyclopentyl]propan-1-one |
|---|---|
| PubChem CID | 10610997 |
| Molecular Formula | C15H30OSi |
| Molecular Weight | 254.49 g/mol |
| Exact Mass | 254.21 |
| IUPAC Name | 1-[tert-butyl(dimethyl)silyl]-3-[(1R,3S)-3-methylcyclopentyl]propan-1-one |
| SMILES | C[C@H]1CC[C@H](CCC(=O)[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C15H30OSi/c1-12-7-8-13(11-12)9-10-14(16)17(5,6)15(2,3)4/h12-13H,7-11H2,1-6H3/t12-,13+/m0/s1 |
| InChIKey | QAMGEWYKATYOSK-QWHCGFSZSA-N |
| XLogP | 4.82 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.49 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|