C14H21N3O4 — CID 106110338
3-[[ethyl-[(6-methyl-2-pyridinyl)methyl]carbamoyl]amino]-2-methoxypropanoic acid (PubChem CID 106110338) has the molecular formula C14H21N3O4 and a molecular weight of 295.34 g/mol. Its IUPAC name is 3-[[ethyl-[(6-methyl-2-pyridinyl)methyl]carbamoyl]amino]-2-methoxypropanoic acid.
| Compound Name | 3-[[ethyl-[(6-methyl-2-pyridinyl)methyl]carbamoyl]amino]-2-methoxypropanoic acid |
|---|---|
| PubChem CID | 106110338 |
| Molecular Formula | C14H21N3O4 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | 3-[[ethyl-[(6-methyl-2-pyridinyl)methyl]carbamoyl]amino]-2-methoxypropanoic acid |
| SMILES | CCN(Cc1cccc(C)n1)C(=O)NCC(OC)C(=O)O |
| InChI | InChI=1S/C14H21N3O4/c1-4-17(9-11-7-5-6-10(2)16-11)14(20)15-8-12(21-3)13(18)19/h5-7,12H,4,8-9H2,1-3H3,(H,15,20)(H,18,19) |
| InChIKey | XFGNULFQAIJKPW-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |