C14H12N2O3 — CID 10611077
4-[[(2-ethoxy-3,4-dioxocyclobuten-1-yl)amino]methyl]benzonitrile (PubChem CID 10611077) has the molecular formula C14H12N2O3 and a molecular weight of 256.26 g/mol. Its IUPAC name is 4-[[(2-ethoxy-3,4-dioxocyclobuten-1-yl)amino]methyl]benzonitrile.
| Compound Name | 4-[[(2-ethoxy-3,4-dioxocyclobuten-1-yl)amino]methyl]benzonitrile |
|---|---|
| PubChem CID | 10611077 |
| Molecular Formula | C14H12N2O3 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 4-[[(2-ethoxy-3,4-dioxocyclobuten-1-yl)amino]methyl]benzonitrile |
| SMILES | CCOc1c(NCc2ccc(C#N)cc2)c(=O)c1=O |
| InChI | InChI=1S/C14H12N2O3/c1-2-19-14-11(12(17)13(14)18)16-8-10-5-3-9(7-15)4-6-10/h3-6,16H,2,8H2,1H3 |
| InChIKey | YHNGAMDPSLWYOL-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|