About 1-O-methyl 4-O-(6-methylhepta-1,6-dien-3-yl) (2S)-2-hydroxybutanedioate
1-O-methyl 4-O-(6-methylhepta-1,6-dien-3-yl) (2S)-2-hydroxybutanedioate (PubChem CID 10611087) has the molecular formula C13H20O5
and a molecular weight of 256.30 g/mol. Its IUPAC name is 1-O-methyl 4-O-(6-methylhepta-1,6-dien-3-yl) (2S)-2-hydroxybutanedioate.
Molecular Properties
| Compound Name | 1-O-methyl 4-O-(6-methylhepta-1,6-dien-3-yl) (2S)-2-hydroxybutanedioate |
| PubChem CID | 10611087 |
| Molecular Formula | C13H20O5 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | 1-O-methyl 4-O-(6-methylhepta-1,6-dien-3-yl) (2S)-2-hydroxybutanedioate |
| SMILES | C=CC(CCC(=C)C)OC(=O)C[C@H](O)C(=O)OC |
| InChI | InChI=1S/C13H20O5/c1-5-10(7-6-9(2)3)18-12(15)8-11(14)13(16)17-4/h5,10-11,14H,1-2,6-8H2,3-4H3/t10?,11-/m0/s1 |
| InChIKey | LZCHKPZLGZSHNU-DTIOYNMSSA-N |
| XLogP | 1.36 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-O-methyl 4-O-(6-methylhepta-1,6-dien-3-yl) (2S)-2-hydroxybutanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-methyl 4-O-(6-methylhepta-1,6-dien-3-yl) (2S)-2-hydroxybutanedioate?
The IUPAC name of 1-O-methyl 4-O-(6-methylhepta-1,6-dien-3-yl) (2S)-2-hydroxybutanedioate (CID 10611087) is 1-O-methyl 4-O-(6-methylhepta-1,6-dien-3-yl) (2S)-2-hydroxybutanedioate.
What is the SMILES notation for 1-O-methyl 4-O-(6-methylhepta-1,6-dien-3-yl) (2S)-2-hydroxybutanedioate?
The canonical SMILES for 1-O-methyl 4-O-(6-methylhepta-1,6-dien-3-yl) (2S)-2-hydroxybutanedioate is C=CC(CCC(=C)C)OC(=O)C[C@H](O)C(=O)OC.
What is the InChIKey of 1-O-methyl 4-O-(6-methylhepta-1,6-dien-3-yl) (2S)-2-hydroxybutanedioate?
The InChIKey is LZCHKPZLGZSHNU-DTIOYNMSSA-N. The full InChI is InChI=1S/C13H20O5/c1-5-10(7-6-9(2)3)18-12(15)8-11(14)13(16)17-4/h5,10-11,14H,1-2,6-8H2,3-4H3/t10?,11-/m0/s1.
What are the key properties of 1-O-methyl 4-O-(6-methylhepta-1,6-dien-3-yl) (2S)-2-hydroxybutanedioate?
1-O-methyl 4-O-(6-methylhepta-1,6-dien-3-yl) (2S)-2-hydroxybutanedioate has a molecular weight of 256.30 g/mol, XLogP of 1.36, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-methyl 4-O-(6-methylhepta-1,6-dien-3-yl) (2S)-2-hydroxybutanedioate is sourced from PubChem (CID 10611087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).