About 3-phenyl-2-(2,2,2-trifluoroacetyl)-1,2-oxazol-5-one
3-phenyl-2-(2,2,2-trifluoroacetyl)-1,2-oxazol-5-one (PubChem CID 10611143) has the molecular formula C11H6F3NO3
and a molecular weight of 257.17 g/mol. Its IUPAC name is 3-phenyl-2-(2,2,2-trifluoroacetyl)-1,2-oxazol-5-one.
Molecular Properties
| Compound Name | 3-phenyl-2-(2,2,2-trifluoroacetyl)-1,2-oxazol-5-one |
| PubChem CID | 10611143 |
| Molecular Formula | C11H6F3NO3 |
| Molecular Weight | 257.17 g/mol |
| Exact Mass | 257.03 |
| IUPAC Name | 3-phenyl-2-(2,2,2-trifluoroacetyl)-1,2-oxazol-5-one |
| SMILES | O=C(n1oc(=O)cc1-c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C11H6F3NO3/c12-11(13,14)10(17)15-8(6-9(16)18-15)7-4-2-1-3-5-7/h1-6H |
| InChIKey | OKKXJQUGEMAERH-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 52.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.17 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-phenyl-2-(2,2,2-trifluoroacetyl)-1,2-oxazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenyl-2-(2,2,2-trifluoroacetyl)-1,2-oxazol-5-one?
The IUPAC name of 3-phenyl-2-(2,2,2-trifluoroacetyl)-1,2-oxazol-5-one (CID 10611143) is 3-phenyl-2-(2,2,2-trifluoroacetyl)-1,2-oxazol-5-one.
What is the SMILES notation for 3-phenyl-2-(2,2,2-trifluoroacetyl)-1,2-oxazol-5-one?
The canonical SMILES for 3-phenyl-2-(2,2,2-trifluoroacetyl)-1,2-oxazol-5-one is O=C(n1oc(=O)cc1-c1ccccc1)C(F)(F)F.
What is the InChIKey of 3-phenyl-2-(2,2,2-trifluoroacetyl)-1,2-oxazol-5-one?
The InChIKey is OKKXJQUGEMAERH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H6F3NO3/c12-11(13,14)10(17)15-8(6-9(16)18-15)7-4-2-1-3-5-7/h1-6H.
What are the key properties of 3-phenyl-2-(2,2,2-trifluoroacetyl)-1,2-oxazol-5-one?
3-phenyl-2-(2,2,2-trifluoroacetyl)-1,2-oxazol-5-one has a molecular weight of 257.17 g/mol, XLogP of 2.31, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenyl-2-(2,2,2-trifluoroacetyl)-1,2-oxazol-5-one is sourced from PubChem (CID 10611143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).