About 3-amino-N-(2-hydroxy-2,4-dimethylpentyl)-2-methoxypropanamide
3-amino-N-(2-hydroxy-2,4-dimethylpentyl)-2-methoxypropanamide (PubChem CID 106113085) has the molecular formula C11H24N2O3
and a molecular weight of 232.32 g/mol. Its IUPAC name is 3-amino-N-(2-hydroxy-2,4-dimethylpentyl)-2-methoxypropanamide.
Molecular Properties
| Compound Name | 3-amino-N-(2-hydroxy-2,4-dimethylpentyl)-2-methoxypropanamide |
| PubChem CID | 106113085 |
| Molecular Formula | C11H24N2O3 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.18 |
| IUPAC Name | 3-amino-N-(2-hydroxy-2,4-dimethylpentyl)-2-methoxypropanamide |
| SMILES | COC(CN)C(=O)NCC(C)(O)CC(C)C |
| InChI | InChI=1S/C11H24N2O3/c1-8(2)5-11(3,15)7-13-10(14)9(6-12)16-4/h8-9,15H,5-7,12H2,1-4H3,(H,13,14) |
| InChIKey | BJGXQDSQIKIOKC-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-amino-N-(2-hydroxy-2,4-dimethylpentyl)-2-methoxypropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-N-(2-hydroxy-2,4-dimethylpentyl)-2-methoxypropanamide?
The IUPAC name of 3-amino-N-(2-hydroxy-2,4-dimethylpentyl)-2-methoxypropanamide (CID 106113085) is 3-amino-N-(2-hydroxy-2,4-dimethylpentyl)-2-methoxypropanamide.
What is the SMILES notation for 3-amino-N-(2-hydroxy-2,4-dimethylpentyl)-2-methoxypropanamide?
The canonical SMILES for 3-amino-N-(2-hydroxy-2,4-dimethylpentyl)-2-methoxypropanamide is COC(CN)C(=O)NCC(C)(O)CC(C)C.
What is the InChIKey of 3-amino-N-(2-hydroxy-2,4-dimethylpentyl)-2-methoxypropanamide?
The InChIKey is BJGXQDSQIKIOKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24N2O3/c1-8(2)5-11(3,15)7-13-10(14)9(6-12)16-4/h8-9,15H,5-7,12H2,1-4H3,(H,13,14).
What are the key properties of 3-amino-N-(2-hydroxy-2,4-dimethylpentyl)-2-methoxypropanamide?
3-amino-N-(2-hydroxy-2,4-dimethylpentyl)-2-methoxypropanamide has a molecular weight of 232.32 g/mol, XLogP of -0.13, 7 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-N-(2-hydroxy-2,4-dimethylpentyl)-2-methoxypropanamide is sourced from PubChem (CID 106113085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).