About 3-amino-N-(2,2-difluoroethyl)-2-methoxypropanamide
3-amino-N-(2,2-difluoroethyl)-2-methoxypropanamide (PubChem CID 106113404) has the molecular formula C6H12F2N2O2
and a molecular weight of 182.17 g/mol. Its IUPAC name is 3-amino-N-(2,2-difluoroethyl)-2-methoxypropanamide.
Molecular Properties
| Compound Name | 3-amino-N-(2,2-difluoroethyl)-2-methoxypropanamide |
| PubChem CID | 106113404 |
| Molecular Formula | C6H12F2N2O2 |
| Molecular Weight | 182.17 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | 3-amino-N-(2,2-difluoroethyl)-2-methoxypropanamide |
| SMILES | COC(CN)C(=O)NCC(F)F |
| InChI | InChI=1S/C6H12F2N2O2/c1-12-4(2-9)6(11)10-3-5(7)8/h4-5H,2-3,9H2,1H3,(H,10,11) |
| InChIKey | QCJMLIDOOXCQSL-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.17 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-amino-N-(2,2-difluoroethyl)-2-methoxypropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-N-(2,2-difluoroethyl)-2-methoxypropanamide?
The IUPAC name of 3-amino-N-(2,2-difluoroethyl)-2-methoxypropanamide (CID 106113404) is 3-amino-N-(2,2-difluoroethyl)-2-methoxypropanamide.
What is the SMILES notation for 3-amino-N-(2,2-difluoroethyl)-2-methoxypropanamide?
The canonical SMILES for 3-amino-N-(2,2-difluoroethyl)-2-methoxypropanamide is COC(CN)C(=O)NCC(F)F.
What is the InChIKey of 3-amino-N-(2,2-difluoroethyl)-2-methoxypropanamide?
The InChIKey is QCJMLIDOOXCQSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12F2N2O2/c1-12-4(2-9)6(11)10-3-5(7)8/h4-5H,2-3,9H2,1H3,(H,10,11).
What are the key properties of 3-amino-N-(2,2-difluoroethyl)-2-methoxypropanamide?
3-amino-N-(2,2-difluoroethyl)-2-methoxypropanamide has a molecular weight of 182.17 g/mol, XLogP of -0.66, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-N-(2,2-difluoroethyl)-2-methoxypropanamide is sourced from PubChem (CID 106113404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).