About 3-amino-2-methoxy-N-(4,4,4-trifluorobutyl)propanamide
3-amino-2-methoxy-N-(4,4,4-trifluorobutyl)propanamide (PubChem CID 106113423) has the molecular formula C8H15F3N2O2
and a molecular weight of 228.21 g/mol. Its IUPAC name is 3-amino-2-methoxy-N-(4,4,4-trifluorobutyl)propanamide.
Molecular Properties
| Compound Name | 3-amino-2-methoxy-N-(4,4,4-trifluorobutyl)propanamide |
| PubChem CID | 106113423 |
| Molecular Formula | C8H15F3N2O2 |
| Molecular Weight | 228.21 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | 3-amino-2-methoxy-N-(4,4,4-trifluorobutyl)propanamide |
| SMILES | COC(CN)C(=O)NCCCC(F)(F)F |
| InChI | InChI=1S/C8H15F3N2O2/c1-15-6(5-12)7(14)13-4-2-3-8(9,10)11/h6H,2-5,12H2,1H3,(H,13,14) |
| InChIKey | YICUMHSTSXXUQA-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.21 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-2-methoxy-N-(4,4,4-trifluorobutyl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-2-methoxy-N-(4,4,4-trifluorobutyl)propanamide?
The IUPAC name of 3-amino-2-methoxy-N-(4,4,4-trifluorobutyl)propanamide (CID 106113423) is 3-amino-2-methoxy-N-(4,4,4-trifluorobutyl)propanamide.
What is the SMILES notation for 3-amino-2-methoxy-N-(4,4,4-trifluorobutyl)propanamide?
The canonical SMILES for 3-amino-2-methoxy-N-(4,4,4-trifluorobutyl)propanamide is COC(CN)C(=O)NCCCC(F)(F)F.
What is the InChIKey of 3-amino-2-methoxy-N-(4,4,4-trifluorobutyl)propanamide?
The InChIKey is YICUMHSTSXXUQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15F3N2O2/c1-15-6(5-12)7(14)13-4-2-3-8(9,10)11/h6H,2-5,12H2,1H3,(H,13,14).
What are the key properties of 3-amino-2-methoxy-N-(4,4,4-trifluorobutyl)propanamide?
3-amino-2-methoxy-N-(4,4,4-trifluorobutyl)propanamide has a molecular weight of 228.21 g/mol, XLogP of 0.42, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-2-methoxy-N-(4,4,4-trifluorobutyl)propanamide is sourced from PubChem (CID 106113423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).