C12H11N3O4 — CID 10611414
(6-amino-5,8-dioxo-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-3-yl) acetate (PubChem CID 10611414) has the molecular formula C12H11N3O4 and a molecular weight of 261.24 g/mol. Its IUPAC name is (6-amino-5,8-dioxo-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-3-yl) acetate.
| Compound Name | (6-amino-5,8-dioxo-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-3-yl) acetate |
|---|---|
| PubChem CID | 10611414 |
| Molecular Formula | C12H11N3O4 |
| Molecular Weight | 261.24 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | (6-amino-5,8-dioxo-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-3-yl) acetate |
| SMILES | CC(=O)OC1CCn2c1nc1c2C(=O)C=C(N)C1=O |
| InChI | InChI=1S/C12H11N3O4/c1-5(16)19-8-2-3-15-10-7(17)4-6(13)11(18)9(10)14-12(8)15/h4,8H,2-3,13H2,1H3 |
| InChIKey | ODBRLUADIJDALZ-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 104.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.24 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|