About 2-methoxy-3-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)propan-1-amine
2-methoxy-3-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)propan-1-amine (PubChem CID 106115044) has the molecular formula C10H20N2O
and a molecular weight of 184.28 g/mol. Its IUPAC name is 2-methoxy-3-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)propan-1-amine.
Molecular Properties
| Compound Name | 2-methoxy-3-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)propan-1-amine |
| PubChem CID | 106115044 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | 2-methoxy-3-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)propan-1-amine |
| SMILES | COC(CN)CN1CC=C(C)CC1 |
| InChI | InChI=1S/C10H20N2O/c1-9-3-5-12(6-4-9)8-10(7-11)13-2/h3,10H,4-8,11H2,1-2H3 |
| InChIKey | BPGDHEVXPXLFOX-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxy-3-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-3-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)propan-1-amine?
The IUPAC name of 2-methoxy-3-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)propan-1-amine (CID 106115044) is 2-methoxy-3-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)propan-1-amine.
What is the SMILES notation for 2-methoxy-3-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)propan-1-amine?
The canonical SMILES for 2-methoxy-3-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)propan-1-amine is COC(CN)CN1CC=C(C)CC1.
What is the InChIKey of 2-methoxy-3-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)propan-1-amine?
The InChIKey is BPGDHEVXPXLFOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2O/c1-9-3-5-12(6-4-9)8-10(7-11)13-2/h3,10H,4-8,11H2,1-2H3.
What are the key properties of 2-methoxy-3-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)propan-1-amine?
2-methoxy-3-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)propan-1-amine has a molecular weight of 184.28 g/mol, XLogP of 0.61, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-3-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)propan-1-amine is sourced from PubChem (CID 106115044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).