C12H13N3O4 — CID 10611559
6,7-diethyl-5-nitro-1,4-dihydroquinoxaline-2,3-dione (PubChem CID 10611559) has the molecular formula C12H13N3O4 and a molecular weight of 263.25 g/mol. Its IUPAC name is 6,7-diethyl-5-nitro-1,4-dihydroquinoxaline-2,3-dione.
| Compound Name | 6,7-diethyl-5-nitro-1,4-dihydroquinoxaline-2,3-dione |
|---|---|
| PubChem CID | 10611559 |
| Molecular Formula | C12H13N3O4 |
| Molecular Weight | 263.25 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | 6,7-diethyl-5-nitro-1,4-dihydroquinoxaline-2,3-dione |
| SMILES | CCc1cc2[nH]c(=O)c(=O)[nH]c2c([N+](=O)[O-])c1CC |
| InChI | InChI=1S/C12H13N3O4/c1-3-6-5-8-9(14-12(17)11(16)13-8)10(15(18)19)7(6)4-2/h5H,3-4H2,1-2H3,(H,13,16)(H,14,17) |
| InChIKey | DSMPVPUNARWELA-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 108.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.25 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|