C12H19N3O4 — CID 106115873
N-[2-(2-hydroxyethyl)pentyl]-2,4-dioxo-1H-pyrimidine-6-carboxamide (PubChem CID 106115873) has the molecular formula C12H19N3O4 and a molecular weight of 269.30 g/mol. Its IUPAC name is N-[2-(2-hydroxyethyl)pentyl]-2,4-dioxo-1H-pyrimidine-6-carboxamide.
| Compound Name | N-[2-(2-hydroxyethyl)pentyl]-2,4-dioxo-1H-pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 106115873 |
| Molecular Formula | C12H19N3O4 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | N-[2-(2-hydroxyethyl)pentyl]-2,4-dioxo-1H-pyrimidine-6-carboxamide |
| SMILES | CCCC(CCO)CNC(=O)c1cc(=O)[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C12H19N3O4/c1-2-3-8(4-5-16)7-13-11(18)9-6-10(17)15-12(19)14-9/h6,8,16H,2-5,7H2,1H3,(H,13,18)(H2,14,15,17,19) |
| InChIKey | MVWYKFLGDJNKPJ-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 115.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |