C15H24N2O3 — CID 106116218
N-[2-(2-aminoethyl)pentyl]-2-hydroxy-4-methoxybenzamide (PubChem CID 106116218) has the molecular formula C15H24N2O3 and a molecular weight of 280.37 g/mol. Its IUPAC name is N-[2-(2-aminoethyl)pentyl]-2-hydroxy-4-methoxybenzamide.
| Compound Name | N-[2-(2-aminoethyl)pentyl]-2-hydroxy-4-methoxybenzamide |
|---|---|
| PubChem CID | 106116218 |
| Molecular Formula | C15H24N2O3 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | N-[2-(2-aminoethyl)pentyl]-2-hydroxy-4-methoxybenzamide |
| SMILES | CCCC(CCN)CNC(=O)c1ccc(OC)cc1O |
| InChI | InChI=1S/C15H24N2O3/c1-3-4-11(7-8-16)10-17-15(19)13-6-5-12(20-2)9-14(13)18/h5-6,9,11,18H,3-4,7-8,10,16H2,1-2H3,(H,17,19) |
| InChIKey | DFEYKPRZNRGMDI-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |