C10H23N3O — CID 106116295
3-[2-(2-aminoethyl)pentyl]-1,1-dimethylurea (PubChem CID 106116295) has the molecular formula C10H23N3O and a molecular weight of 201.31 g/mol. Its IUPAC name is 3-[2-(2-aminoethyl)pentyl]-1,1-dimethylurea.
| Compound Name | 3-[2-(2-aminoethyl)pentyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 106116295 |
| Molecular Formula | C10H23N3O |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.18 |
| IUPAC Name | 3-[2-(2-aminoethyl)pentyl]-1,1-dimethylurea |
| SMILES | CCCC(CCN)CNC(=O)N(C)C |
| InChI | InChI=1S/C10H23N3O/c1-4-5-9(6-7-11)8-12-10(14)13(2)3/h9H,4-8,11H2,1-3H3,(H,12,14) |
| InChIKey | MQBVFLHLTXPDDH-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |