About 2-propyl-N-(tetrazolo[1,5-a]pyrazin-5-yl)butane-1,4-diamine
2-propyl-N-(tetrazolo[1,5-a]pyrazin-5-yl)butane-1,4-diamine (PubChem CID 106116411) has the molecular formula C11H19N7
and a molecular weight of 249.32 g/mol. Its IUPAC name is 2-propyl-N-(tetrazolo[1,5-a]pyrazin-5-yl)butane-1,4-diamine.
Molecular Properties
| Compound Name | 2-propyl-N-(tetrazolo[1,5-a]pyrazin-5-yl)butane-1,4-diamine |
| PubChem CID | 106116411 |
| Molecular Formula | C11H19N7 |
| Molecular Weight | 249.32 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | 2-propyl-N-(tetrazolo[1,5-a]pyrazin-5-yl)butane-1,4-diamine |
| SMILES | CCCC(CCN)CNc1cncc2nnnn12 |
| InChI | InChI=1S/C11H19N7/c1-2-3-9(4-5-12)6-14-10-7-13-8-11-15-16-17-18(10)11/h7-9,14H,2-6,12H2,1H3 |
| InChIKey | BOGVVGHPWKMAJJ-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 94.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.32 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-propyl-N-(tetrazolo[1,5-a]pyrazin-5-yl)butane-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propyl-N-(tetrazolo[1,5-a]pyrazin-5-yl)butane-1,4-diamine?
The IUPAC name of 2-propyl-N-(tetrazolo[1,5-a]pyrazin-5-yl)butane-1,4-diamine (CID 106116411) is 2-propyl-N-(tetrazolo[1,5-a]pyrazin-5-yl)butane-1,4-diamine.
What is the SMILES notation for 2-propyl-N-(tetrazolo[1,5-a]pyrazin-5-yl)butane-1,4-diamine?
The canonical SMILES for 2-propyl-N-(tetrazolo[1,5-a]pyrazin-5-yl)butane-1,4-diamine is CCCC(CCN)CNc1cncc2nnnn12.
What is the InChIKey of 2-propyl-N-(tetrazolo[1,5-a]pyrazin-5-yl)butane-1,4-diamine?
The InChIKey is BOGVVGHPWKMAJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N7/c1-2-3-9(4-5-12)6-14-10-7-13-8-11-15-16-17-18(10)11/h7-9,14H,2-6,12H2,1H3.
What are the key properties of 2-propyl-N-(tetrazolo[1,5-a]pyrazin-5-yl)butane-1,4-diamine?
2-propyl-N-(tetrazolo[1,5-a]pyrazin-5-yl)butane-1,4-diamine has a molecular weight of 249.32 g/mol, XLogP of 0.70, 7 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propyl-N-(tetrazolo[1,5-a]pyrazin-5-yl)butane-1,4-diamine is sourced from PubChem (CID 106116411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).