C14H26N4 — CID 106116522
2-propyl-N-(6-propylpyrimidin-4-yl)butane-1,4-diamine (PubChem CID 106116522) has the molecular formula C14H26N4 and a molecular weight of 250.39 g/mol. Its IUPAC name is 2-propyl-N-(6-propylpyrimidin-4-yl)butane-1,4-diamine.
| Compound Name | 2-propyl-N-(6-propylpyrimidin-4-yl)butane-1,4-diamine |
|---|---|
| PubChem CID | 106116522 |
| Molecular Formula | C14H26N4 |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.22 |
| IUPAC Name | 2-propyl-N-(6-propylpyrimidin-4-yl)butane-1,4-diamine |
| SMILES | CCCc1cc(NCC(CCC)CCN)ncn1 |
| InChI | InChI=1S/C14H26N4/c1-3-5-12(7-8-15)10-16-14-9-13(6-4-2)17-11-18-14/h9,11-12H,3-8,10,15H2,1-2H3,(H,16,17,18) |
| InChIKey | VZONRVGYDHMJBW-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |