C11H19NO3 — CID 106116951
1-[2-(2-hydroxyethyl)pentyl]pyrrolidine-2,5-dione (PubChem CID 106116951) has the molecular formula C11H19NO3 and a molecular weight of 213.28 g/mol. Its IUPAC name is 1-[2-(2-hydroxyethyl)pentyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[2-(2-hydroxyethyl)pentyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 106116951 |
| Molecular Formula | C11H19NO3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.14 |
| IUPAC Name | 1-[2-(2-hydroxyethyl)pentyl]pyrrolidine-2,5-dione |
| SMILES | CCCC(CCO)CN1C(=O)CCC1=O |
| InChI | InChI=1S/C11H19NO3/c1-2-3-9(6-7-13)8-12-10(14)4-5-11(12)15/h9,13H,2-8H2,1H3 |
| InChIKey | OAPYBGKOHNNDSQ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|