C16H30ClNO — CID 106117575
N-[2-(2-chloroethyl)pentyl]-2,2-dimethylcyclohexane-1-carboxamide (PubChem CID 106117575) has the molecular formula C16H30ClNO and a molecular weight of 287.88 g/mol. Its IUPAC name is N-[2-(2-chloroethyl)pentyl]-2,2-dimethylcyclohexane-1-carboxamide.
| Compound Name | N-[2-(2-chloroethyl)pentyl]-2,2-dimethylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 106117575 |
| Molecular Formula | C16H30ClNO |
| Molecular Weight | 287.88 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | N-[2-(2-chloroethyl)pentyl]-2,2-dimethylcyclohexane-1-carboxamide |
| SMILES | CCCC(CCCl)CNC(=O)C1CCCCC1(C)C |
| InChI | InChI=1S/C16H30ClNO/c1-4-7-13(9-11-17)12-18-15(19)14-8-5-6-10-16(14,2)3/h13-14H,4-12H2,1-3H3,(H,18,19) |
| InChIKey | WEWJJENIDCVQIC-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.88 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|