C8H11IO2 — CID 10611768
(6Z)-2-(iodomethyl)-2,3,4,5-tetrahydrooxocin-8-one (PubChem CID 10611768) has the molecular formula C8H11IO2 and a molecular weight of 266.08 g/mol. Its IUPAC name is (6Z)-2-(iodomethyl)-2,3,4,5-tetrahydrooxocin-8-one.
| Compound Name | (6Z)-2-(iodomethyl)-2,3,4,5-tetrahydrooxocin-8-one |
|---|---|
| PubChem CID | 10611768 |
| Molecular Formula | C8H11IO2 |
| Molecular Weight | 266.08 g/mol |
| Exact Mass | 265.98 |
| IUPAC Name | (6Z)-2-(iodomethyl)-2,3,4,5-tetrahydrooxocin-8-one |
| SMILES | O=C1/C=C\CCCC(CI)O1 |
| InChI | InChI=1S/C8H11IO2/c9-6-7-4-2-1-3-5-8(10)11-7/h3,5,7H,1-2,4,6H2/b5-3- |
| InChIKey | BJAIDEYGDCIFTH-HYXAFXHYSA-N |
| XLogP | 2.07 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.08 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|