About 8-(3-nitrophenyl)-1,7-naphthyridin-6-amine
8-(3-nitrophenyl)-1,7-naphthyridin-6-amine (PubChem CID 10611778) has the molecular formula C14H10N4O2
and a molecular weight of 266.26 g/mol. Its IUPAC name is 8-(3-nitrophenyl)-1,7-naphthyridin-6-amine.
Molecular Properties
| Compound Name | 8-(3-nitrophenyl)-1,7-naphthyridin-6-amine |
| PubChem CID | 10611778 |
| Molecular Formula | C14H10N4O2 |
| Molecular Weight | 266.26 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | 8-(3-nitrophenyl)-1,7-naphthyridin-6-amine |
| SMILES | Nc1cc2cccnc2c(-c2cccc([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C14H10N4O2/c15-12-8-10-4-2-6-16-13(10)14(17-12)9-3-1-5-11(7-9)18(19)20/h1-8H,(H2,15,17) |
| InChIKey | QEROEWFWSVQFIF-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 94.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.26 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 8-(3-nitrophenyl)-1,7-naphthyridin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(3-nitrophenyl)-1,7-naphthyridin-6-amine?
The IUPAC name of 8-(3-nitrophenyl)-1,7-naphthyridin-6-amine (CID 10611778) is 8-(3-nitrophenyl)-1,7-naphthyridin-6-amine.
What is the SMILES notation for 8-(3-nitrophenyl)-1,7-naphthyridin-6-amine?
The canonical SMILES for 8-(3-nitrophenyl)-1,7-naphthyridin-6-amine is Nc1cc2cccnc2c(-c2cccc([N+](=O)[O-])c2)n1.
What is the InChIKey of 8-(3-nitrophenyl)-1,7-naphthyridin-6-amine?
The InChIKey is QEROEWFWSVQFIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10N4O2/c15-12-8-10-4-2-6-16-13(10)14(17-12)9-3-1-5-11(7-9)18(19)20/h1-8H,(H2,15,17).
What are the key properties of 8-(3-nitrophenyl)-1,7-naphthyridin-6-amine?
8-(3-nitrophenyl)-1,7-naphthyridin-6-amine has a molecular weight of 266.26 g/mol, XLogP of 2.79, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(3-nitrophenyl)-1,7-naphthyridin-6-amine is sourced from PubChem (CID 10611778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).