C17H26BrNOS — CID 106118052
N-[2-(2-bromoethyl)pentyl]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carboxamide (PubChem CID 106118052) has the molecular formula C17H26BrNOS and a molecular weight of 372.37 g/mol. Its IUPAC name is N-[2-(2-bromoethyl)pentyl]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carboxamide.
| Compound Name | N-[2-(2-bromoethyl)pentyl]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 106118052 |
| Molecular Formula | C17H26BrNOS |
| Molecular Weight | 372.37 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | N-[2-(2-bromoethyl)pentyl]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carboxamide |
| SMILES | CCCC(CCBr)CNC(=O)c1cc2c(s1)CCCCC2 |
| InChI | InChI=1S/C17H26BrNOS/c1-2-6-13(9-10-18)12-19-17(20)16-11-14-7-4-3-5-8-15(14)21-16/h11,13H,2-10,12H2,1H3,(H,19,20) |
| InChIKey | SBWQVDQIJPTSFZ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.37 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|