About 2-(3,3,3-trifluoro-1-propylsulfanylpropyl)cyclohexan-1-one
2-(3,3,3-trifluoro-1-propylsulfanylpropyl)cyclohexan-1-one (PubChem CID 10611963) has the molecular formula C12H19F3OS
and a molecular weight of 268.34 g/mol. Its IUPAC name is 2-(3,3,3-trifluoro-1-propylsulfanylpropyl)cyclohexan-1-one.
Molecular Properties
| Compound Name | 2-(3,3,3-trifluoro-1-propylsulfanylpropyl)cyclohexan-1-one |
| PubChem CID | 10611963 |
| Molecular Formula | C12H19F3OS |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 2-(3,3,3-trifluoro-1-propylsulfanylpropyl)cyclohexan-1-one |
| SMILES | CCCSC(CC(F)(F)F)C1CCCCC1=O |
| InChI | InChI=1S/C12H19F3OS/c1-2-7-17-11(8-12(13,14)15)9-5-3-4-6-10(9)16/h9,11H,2-8H2,1H3 |
| InChIKey | MWIJBMNUAVTJDQ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(3,3,3-trifluoro-1-propylsulfanylpropyl)cyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,3,3-trifluoro-1-propylsulfanylpropyl)cyclohexan-1-one?
The IUPAC name of 2-(3,3,3-trifluoro-1-propylsulfanylpropyl)cyclohexan-1-one (CID 10611963) is 2-(3,3,3-trifluoro-1-propylsulfanylpropyl)cyclohexan-1-one.
What is the SMILES notation for 2-(3,3,3-trifluoro-1-propylsulfanylpropyl)cyclohexan-1-one?
The canonical SMILES for 2-(3,3,3-trifluoro-1-propylsulfanylpropyl)cyclohexan-1-one is CCCSC(CC(F)(F)F)C1CCCCC1=O.
What is the InChIKey of 2-(3,3,3-trifluoro-1-propylsulfanylpropyl)cyclohexan-1-one?
The InChIKey is MWIJBMNUAVTJDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19F3OS/c1-2-7-17-11(8-12(13,14)15)9-5-3-4-6-10(9)16/h9,11H,2-8H2,1H3.
What are the key properties of 2-(3,3,3-trifluoro-1-propylsulfanylpropyl)cyclohexan-1-one?
2-(3,3,3-trifluoro-1-propylsulfanylpropyl)cyclohexan-1-one has a molecular weight of 268.34 g/mol, XLogP of 4.21, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,3,3-trifluoro-1-propylsulfanylpropyl)cyclohexan-1-one is sourced from PubChem (CID 10611963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).