C15H28O2Si — CID 10612000
2,2-ditert-butyl-6,6-dimethyl-4,6a-dihydrofuro[3,4-d]oxasilole (PubChem CID 10612000) has the molecular formula C15H28O2Si and a molecular weight of 268.47 g/mol. Its IUPAC name is 2,2-ditert-butyl-6,6-dimethyl-4,6a-dihydrofuro[3,4-d]oxasilole.
| Compound Name | 2,2-ditert-butyl-6,6-dimethyl-4,6a-dihydrofuro[3,4-d]oxasilole |
|---|---|
| PubChem CID | 10612000 |
| Molecular Formula | C15H28O2Si |
| Molecular Weight | 268.47 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | 2,2-ditert-butyl-6,6-dimethyl-4,6a-dihydrofuro[3,4-d]oxasilole |
| SMILES | CC1(C)OCC2=C[Si](C(C)(C)C)(C(C)(C)C)OC21 |
| InChI | InChI=1S/C15H28O2Si/c1-13(2,3)18(14(4,5)6)10-11-9-16-15(7,8)12(11)17-18/h10,12H,9H2,1-8H3 |
| InChIKey | QZDSQNKXINYMDL-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.47 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|