C15H21ClO2 — CID 10612007
(1S)-5-(2-chloroethyl)-4-(hydroxymethyl)-2,2,6-trimethyl-1,3-dihydroinden-1-ol (PubChem CID 10612007) has the molecular formula C15H21ClO2 and a molecular weight of 268.78 g/mol. Its IUPAC name is (1S)-5-(2-chloroethyl)-4-(hydroxymethyl)-2,2,6-trimethyl-1,3-dihydroinden-1-ol.
| Compound Name | (1S)-5-(2-chloroethyl)-4-(hydroxymethyl)-2,2,6-trimethyl-1,3-dihydroinden-1-ol |
|---|---|
| PubChem CID | 10612007 |
| Molecular Formula | C15H21ClO2 |
| Molecular Weight | 268.78 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | (1S)-5-(2-chloroethyl)-4-(hydroxymethyl)-2,2,6-trimethyl-1,3-dihydroinden-1-ol |
| SMILES | Cc1cc2c(c(CO)c1CCCl)CC(C)(C)[C@@H]2O |
| InChI | InChI=1S/C15H21ClO2/c1-9-6-11-12(7-15(2,3)14(11)18)13(8-17)10(9)4-5-16/h6,14,17-18H,4-5,7-8H2,1-3H3/t14-/m1/s1 |
| InChIKey | PTBKVVLMZYDRHF-CQSZACIVSA-N |
| XLogP | 2.88 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.78 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|