C14H15F2NO4 — CID 106120281
4,5-difluoro-2-[(3-hydroxycyclopentyl)methylcarbamoyl]benzoic acid (PubChem CID 106120281) has the molecular formula C14H15F2NO4 and a molecular weight of 299.27 g/mol. Its IUPAC name is 4,5-difluoro-2-[(3-hydroxycyclopentyl)methylcarbamoyl]benzoic acid.
| Compound Name | 4,5-difluoro-2-[(3-hydroxycyclopentyl)methylcarbamoyl]benzoic acid |
|---|---|
| PubChem CID | 106120281 |
| Molecular Formula | C14H15F2NO4 |
| Molecular Weight | 299.27 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | 4,5-difluoro-2-[(3-hydroxycyclopentyl)methylcarbamoyl]benzoic acid |
| SMILES | O=C(O)c1cc(F)c(F)cc1C(=O)NCC1CCC(O)C1 |
| InChI | InChI=1S/C14H15F2NO4/c15-11-4-9(10(14(20)21)5-12(11)16)13(19)17-6-7-1-2-8(18)3-7/h4-5,7-8,18H,1-3,6H2,(H,17,19)(H,20,21) |
| InChIKey | PNVFYIMGTKFLMS-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.27 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |