C11H23NO3 — CID 106121090
3-[(1,1-dimethoxypropan-2-ylamino)methyl]cyclopentan-1-ol (PubChem CID 106121090) has the molecular formula C11H23NO3 and a molecular weight of 217.31 g/mol. Its IUPAC name is 3-[(1,1-dimethoxypropan-2-ylamino)methyl]cyclopentan-1-ol.
| Compound Name | 3-[(1,1-dimethoxypropan-2-ylamino)methyl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 106121090 |
| Molecular Formula | C11H23NO3 |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.17 |
| IUPAC Name | 3-[(1,1-dimethoxypropan-2-ylamino)methyl]cyclopentan-1-ol |
| SMILES | COC(OC)C(C)NCC1CCC(O)C1 |
| InChI | InChI=1S/C11H23NO3/c1-8(11(14-2)15-3)12-7-9-4-5-10(13)6-9/h8-13H,4-7H2,1-3H3 |
| InChIKey | BCCVHMBPFHOAOE-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|