About 17-oxa-1,4,8,11-tetrazabicyclo[6.6.5]nonadecane
17-oxa-1,4,8,11-tetrazabicyclo[6.6.5]nonadecane (PubChem CID 10612129) has the molecular formula C14H30N4O
and a molecular weight of 270.42 g/mol. Its IUPAC name is 17-oxa-1,4,8,11-tetrazabicyclo[6.6.5]nonadecane.
Molecular Properties
| Compound Name | 17-oxa-1,4,8,11-tetrazabicyclo[6.6.5]nonadecane |
| PubChem CID | 10612129 |
| Molecular Formula | C14H30N4O |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.24 |
| IUPAC Name | 17-oxa-1,4,8,11-tetrazabicyclo[6.6.5]nonadecane |
| SMILES | C1CNCCN2CCCNCCN(C1)CCOCC2 |
| InChI | InChI=1S/C14H30N4O/c1-3-15-5-10-18-8-2-4-16-6-9-17(7-1)11-13-19-14-12-18/h15-16H,1-14H2 |
| InChIKey | GWKGUWKMQWAVJD-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 39.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'crown_ether', 'substructure': 'N/A'} |
|---|
Analyze 17-oxa-1,4,8,11-tetrazabicyclo[6.6.5]nonadecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 17-oxa-1,4,8,11-tetrazabicyclo[6.6.5]nonadecane?
The IUPAC name of 17-oxa-1,4,8,11-tetrazabicyclo[6.6.5]nonadecane (CID 10612129) is 17-oxa-1,4,8,11-tetrazabicyclo[6.6.5]nonadecane.
What is the SMILES notation for 17-oxa-1,4,8,11-tetrazabicyclo[6.6.5]nonadecane?
The canonical SMILES for 17-oxa-1,4,8,11-tetrazabicyclo[6.6.5]nonadecane is C1CNCCN2CCCNCCN(C1)CCOCC2.
What is the InChIKey of 17-oxa-1,4,8,11-tetrazabicyclo[6.6.5]nonadecane?
The InChIKey is GWKGUWKMQWAVJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H30N4O/c1-3-15-5-10-18-8-2-4-16-6-9-17(7-1)11-13-19-14-12-18/h15-16H,1-14H2.
What are the key properties of 17-oxa-1,4,8,11-tetrazabicyclo[6.6.5]nonadecane?
17-oxa-1,4,8,11-tetrazabicyclo[6.6.5]nonadecane has a molecular weight of 270.42 g/mol, XLogP of -0.41, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 17-oxa-1,4,8,11-tetrazabicyclo[6.6.5]nonadecane is sourced from PubChem (CID 10612129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).