About N-[(4-hydroxycyclohexyl)methyl]-3,5,5-trimethylhexanamide
N-[(4-hydroxycyclohexyl)methyl]-3,5,5-trimethylhexanamide (PubChem CID 106122177) has the molecular formula C16H31NO2
and a molecular weight of 269.43 g/mol. Its IUPAC name is N-[(4-hydroxycyclohexyl)methyl]-3,5,5-trimethylhexanamide.
Molecular Properties
| Compound Name | N-[(4-hydroxycyclohexyl)methyl]-3,5,5-trimethylhexanamide |
| PubChem CID | 106122177 |
| Molecular Formula | C16H31NO2 |
| Molecular Weight | 269.43 g/mol |
| Exact Mass | 269.24 |
| IUPAC Name | N-[(4-hydroxycyclohexyl)methyl]-3,5,5-trimethylhexanamide |
| SMILES | CC(CC(=O)NCC1CCC(O)CC1)CC(C)(C)C |
| InChI | InChI=1S/C16H31NO2/c1-12(10-16(2,3)4)9-15(19)17-11-13-5-7-14(18)8-6-13/h12-14,18H,5-11H2,1-4H3,(H,17,19) |
| InChIKey | MEMNVVKLUSXOAR-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.43 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(4-hydroxycyclohexyl)methyl]-3,5,5-trimethylhexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4-hydroxycyclohexyl)methyl]-3,5,5-trimethylhexanamide?
The IUPAC name of N-[(4-hydroxycyclohexyl)methyl]-3,5,5-trimethylhexanamide (CID 106122177) is N-[(4-hydroxycyclohexyl)methyl]-3,5,5-trimethylhexanamide.
What is the SMILES notation for N-[(4-hydroxycyclohexyl)methyl]-3,5,5-trimethylhexanamide?
The canonical SMILES for N-[(4-hydroxycyclohexyl)methyl]-3,5,5-trimethylhexanamide is CC(CC(=O)NCC1CCC(O)CC1)CC(C)(C)C.
What is the InChIKey of N-[(4-hydroxycyclohexyl)methyl]-3,5,5-trimethylhexanamide?
The InChIKey is MEMNVVKLUSXOAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H31NO2/c1-12(10-16(2,3)4)9-15(19)17-11-13-5-7-14(18)8-6-13/h12-14,18H,5-11H2,1-4H3,(H,17,19).
What are the key properties of N-[(4-hydroxycyclohexyl)methyl]-3,5,5-trimethylhexanamide?
N-[(4-hydroxycyclohexyl)methyl]-3,5,5-trimethylhexanamide has a molecular weight of 269.43 g/mol, XLogP of 3.12, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4-hydroxycyclohexyl)methyl]-3,5,5-trimethylhexanamide is sourced from PubChem (CID 106122177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).