C14H19Cl2N — CID 106122381
1-(3-chlorocyclohexyl)-N-[(2-chlorophenyl)methyl]methanamine (PubChem CID 106122381) has the molecular formula C14H19Cl2N and a molecular weight of 272.22 g/mol. Its IUPAC name is 1-(3-chlorocyclohexyl)-N-[(2-chlorophenyl)methyl]methanamine.
| Compound Name | 1-(3-chlorocyclohexyl)-N-[(2-chlorophenyl)methyl]methanamine |
|---|---|
| PubChem CID | 106122381 |
| Molecular Formula | C14H19Cl2N |
| Molecular Weight | 272.22 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | 1-(3-chlorocyclohexyl)-N-[(2-chlorophenyl)methyl]methanamine |
| SMILES | Clc1ccccc1CNCC1CCCC(Cl)C1 |
| InChI | InChI=1S/C14H19Cl2N/c15-13-6-3-4-11(8-13)9-17-10-12-5-1-2-7-14(12)16/h1-2,5,7,11,13,17H,3-4,6,8-10H2 |
| InChIKey | FOMHKOVSIWQCHN-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.22 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|