C11H17NO2 — CID 106123398
N-[(4-hydroxycyclohexyl)methyl]but-2-ynamide (PubChem CID 106123398) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is N-[(4-hydroxycyclohexyl)methyl]but-2-ynamide.
| Compound Name | N-[(4-hydroxycyclohexyl)methyl]but-2-ynamide |
|---|---|
| PubChem CID | 106123398 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | N-[(4-hydroxycyclohexyl)methyl]but-2-ynamide |
| SMILES | CC#CC(=O)NCC1CCC(O)CC1 |
| InChI | InChI=1S/C11H17NO2/c1-2-3-11(14)12-8-9-4-6-10(13)7-5-9/h9-10,13H,4-8H2,1H3,(H,12,14) |
| InChIKey | BVIGTTULBCSHMY-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|